C21H22N4O — CID 743363
16-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 743363) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 16-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 743363 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 16-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | C[C@@H]1CN(c2c3c(c(C#N)c4nc5ccccc5n24)CCC3)C[C@H](C)O1 |
| InChI | InChI=1S/C21H22N4O/c1-13-11-24(12-14(2)26-13)21-16-7-5-6-15(16)17(10-22)20-23-18-8-3-4-9-19(18)25(20)21/h3-4,8-9,13-14H,5-7,11-12H2,1-2H3/t13-,14+ |
| InChIKey | ODDCOAJSJSWGGF-OKILXGFUSA-N |
| XLogP | 3.46 |
| TPSA | 53.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |