C24H22N6 — CID 71274929
16-(4-pyridin-4-ylpiperazin-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 71274929) has the molecular formula C24H22N6 and a molecular weight of 394.48 g/mol. Its IUPAC name is 16-(4-pyridin-4-ylpiperazin-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-(4-pyridin-4-ylpiperazin-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 71274929 |
| Molecular Formula | C24H22N6 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 16-(4-pyridin-4-ylpiperazin-1-yl)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | N#Cc1c2c(c(N3CCN(c4ccncc4)CC3)n3c1nc1ccccc13)CCC2 |
| InChI | InChI=1S/C24H22N6/c25-16-20-18-4-3-5-19(18)24(30-22-7-2-1-6-21(22)27-23(20)30)29-14-12-28(13-15-29)17-8-10-26-11-9-17/h1-2,6-11H,3-5,12-15H2 |
| InChIKey | SIHXKEDWDHJXND-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |