C18H17N5O — CID 71274908
16-piperazin-1-yl-13-oxa-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 71274908) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 16-piperazin-1-yl-13-oxa-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-piperazin-1-yl-13-oxa-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 71274908 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 16-piperazin-1-yl-13-oxa-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | N#Cc1c2c(c(N3CCNCC3)n3c1nc1ccccc13)COC2 |
| InChI | InChI=1S/C18H17N5O/c19-9-12-13-10-24-11-14(13)18(22-7-5-20-6-8-22)23-16-4-2-1-3-15(16)21-17(12)23/h1-4,20H,5-8,10-11H2 |
| InChIKey | RUIAKVPFTHHVOV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |