C21H23ClN4O — CID 160574643
16-[3-(methoxymethyl)pyrrolidin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrochloride (PubChem CID 160574643) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is 16-[3-(methoxymethyl)pyrrolidin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrochloride.
| Compound Name | 16-[3-(methoxymethyl)pyrrolidin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 160574643 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 16-[3-(methoxymethyl)pyrrolidin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrochloride |
| SMILES | COCC1CCN(c2c3c(c(C#N)c4nc5ccccc5n24)CCC3)C1.Cl |
| InChI | InChI=1S/C21H22N4O.ClH/c1-26-13-14-9-10-24(12-14)21-16-6-4-5-15(16)17(11-22)20-23-18-7-2-3-8-19(18)25(20)21;/h2-3,7-8,14H,4-6,9-10,12-13H2,1H3;1H |
| InChIKey | QCSHQBQJJUVYDU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |