C37H34F2N2O5 — CID 135354271
N-[4-[4-(2,4-difluorophenoxy)-3-(4-ethoxy-1-methyl-6-oxo-3-pyridinyl)phenyl]-4-phenylbutyl]-2-hydroxybenzamide (PubChem CID 135354271) has the molecular formula C37H34F2N2O5 and a molecular weight of 624.68 g/mol. Its IUPAC name is N-[4-[4-(2,4-difluorophenoxy)-3-(4-ethoxy-1-methyl-6-oxo-3-pyridinyl)phenyl]-4-phenylbutyl]-2-hydroxybenzamide.
| Compound Name | N-[4-[4-(2,4-difluorophenoxy)-3-(4-ethoxy-1-methyl-6-oxo-3-pyridinyl)phenyl]-4-phenylbutyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135354271 |
| Molecular Formula | C37H34F2N2O5 |
| Molecular Weight | 624.68 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | N-[4-[4-(2,4-difluorophenoxy)-3-(4-ethoxy-1-methyl-6-oxo-3-pyridinyl)phenyl]-4-phenylbutyl]-2-hydroxybenzamide |
| SMILES | CCOc1cc(=O)n(C)cc1-c1cc(C(CCCNC(=O)c2ccccc2O)c2ccccc2)ccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C37H34F2N2O5/c1-3-45-35-22-36(43)41(2)23-30(35)29-20-25(15-17-33(29)46-34-18-16-26(38)21-31(34)39)27(24-10-5-4-6-11-24)13-9-19-40-37(44)28-12-7-8-14-32(28)42/h4-8,10-12,14-18,20-23,27,42H,3,9,13,19H2,1-2H3,(H,40,44) |
| InChIKey | LEFKXKPLVBKSBS-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|