C26H26FNO4 — CID 135340814
N-[4-(4-fluorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide (PubChem CID 135340814) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135340814 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[4-(4-fluorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
| SMILES | CC1=C(C)C(=O)C(C(CCCNC(=O)c2ccccc2O)c2ccc(F)cc2)=C(C)C1=O |
| InChI | InChI=1S/C26H26FNO4/c1-15-16(2)25(31)23(17(3)24(15)30)20(18-10-12-19(27)13-11-18)8-6-14-28-26(32)21-7-4-5-9-22(21)29/h4-5,7,9-13,20,29H,6,8,14H2,1-3H3,(H,28,32) |
| InChIKey | YOWHZVLTUQJNNL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|