C27H26N2O4 — CID 135340847
N-[4-(4-cyanophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide (PubChem CID 135340847) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[4-(4-cyanophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide.
| Compound Name | N-[4-(4-cyanophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135340847 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[4-(4-cyanophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
| SMILES | CC1=C(C)C(=O)C(C(CCCNC(=O)c2ccccc2O)c2ccc(C#N)cc2)=C(C)C1=O |
| InChI | InChI=1S/C27H26N2O4/c1-16-17(2)26(32)24(18(3)25(16)31)21(20-12-10-19(15-28)11-13-20)8-6-14-29-27(33)22-7-4-5-9-23(22)30/h4-5,7,9-13,21,30H,6,8,14H2,1-3H3,(H,29,33) |
| InChIKey | ARTNMMNPQYPJIA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|