C26H25Cl2NO4 — CID 135340827
N-[4-(3,5-dichlorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide (PubChem CID 135340827) has the molecular formula C26H25Cl2NO4 and a molecular weight of 486.40 g/mol. Its IUPAC name is N-[4-(3,5-dichlorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide.
| Compound Name | N-[4-(3,5-dichlorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 135340827 |
| Molecular Formula | C26H25Cl2NO4 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | N-[4-(3,5-dichlorophenyl)-4-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butyl]-2-hydroxybenzamide |
| SMILES | CC1=C(C)C(=O)C(C(CCCNC(=O)c2ccccc2O)c2cc(Cl)cc(Cl)c2)=C(C)C1=O |
| InChI | InChI=1S/C26H25Cl2NO4/c1-14-15(2)25(32)23(16(3)24(14)31)20(17-11-18(27)13-19(28)12-17)8-6-10-29-26(33)21-7-4-5-9-22(21)30/h4-5,7,9,11-13,20,30H,6,8,10H2,1-3H3,(H,29,33) |
| InChIKey | PEVBRPJCMQDIFW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|