About 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride
5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride (PubChem CID 135354686) has the molecular formula C14H12Cl2N4O2
and a molecular weight of 339.18 g/mol. Its IUPAC name is 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride |
| PubChem CID | 135354686 |
| Molecular Formula | C14H12Cl2N4O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride |
| SMILES | Cl.Cn1nc(Cc2ccc3ncc(Cl)cc3c2)nc1C(=O)O |
| InChI | InChI=1S/C14H11ClN4O2.ClH/c1-19-13(14(20)21)17-12(18-19)5-8-2-3-11-9(4-8)6-10(15)7-16-11;/h2-4,6-7H,5H2,1H3,(H,20,21);1H |
| InChIKey | PVTSDERQSGKDOH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride?
The IUPAC name of 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride (CID 135354686) is 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride?
The canonical SMILES for 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride is Cl.Cn1nc(Cc2ccc3ncc(Cl)cc3c2)nc1C(=O)O.
What is the InChIKey of 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride?
The InChIKey is PVTSDERQSGKDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN4O2.ClH/c1-19-13(14(20)21)17-12(18-19)5-8-2-3-11-9(4-8)6-10(15)7-16-11;/h2-4,6-7H,5H2,1H3,(H,20,21);1H.
What are the key properties of 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride?
5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride has a molecular weight of 339.18 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-chloroquinolin-6-yl)methyl]-2-methyl-1,2,4-triazole-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 135354686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).