C15H12F2N6O2 — CID 135357622
4-[[5-(4-aminophenyl)tetrazol-2-yl]methyl]-3,5-difluoro-N-hydroxybenzamide (PubChem CID 135357622) has the molecular formula C15H12F2N6O2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 4-[[5-(4-aminophenyl)tetrazol-2-yl]methyl]-3,5-difluoro-N-hydroxybenzamide.
| Compound Name | 4-[[5-(4-aminophenyl)tetrazol-2-yl]methyl]-3,5-difluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135357622 |
| Molecular Formula | C15H12F2N6O2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[[5-(4-aminophenyl)tetrazol-2-yl]methyl]-3,5-difluoro-N-hydroxybenzamide |
| SMILES | Nc1ccc(-c2nnn(Cc3c(F)cc(C(=O)NO)cc3F)n2)cc1 |
| InChI | InChI=1S/C15H12F2N6O2/c16-12-5-9(15(24)21-25)6-13(17)11(12)7-23-20-14(19-22-23)8-1-3-10(18)4-2-8/h1-6,25H,7,18H2,(H,21,24) |
| InChIKey | LHBOAIADGXZNHD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|