C16H12F3N5O2 — CID 135358004
N-hydroxy-4-[[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]methyl]benzamide (PubChem CID 135358004) has the molecular formula C16H12F3N5O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is N-hydroxy-4-[[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 135358004 |
| Molecular Formula | C16H12F3N5O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-hydroxy-4-[[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]methyl]benzamide |
| SMILES | O=C(NO)c1ccc(Cn2nnc(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C16H12F3N5O2/c17-16(18,19)13-7-5-11(6-8-13)14-20-23-24(21-14)9-10-1-3-12(4-2-10)15(25)22-26/h1-8,26H,9H2,(H,22,25) |
| InChIKey | ZDZCBKYMNKPPMJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|