C20H23N5O4S2 — CID 135358053
4-[[5-[3-(diethylsulfamoyl)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxybenzamide (PubChem CID 135358053) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-[[5-[3-(diethylsulfamoyl)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxybenzamide.
| Compound Name | 4-[[5-[3-(diethylsulfamoyl)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135358053 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[[5-[3-(diethylsulfamoyl)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-hydroxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(Sc3ccc(C(=O)NO)cc3)n2C)c1 |
| InChI | InChI=1S/C20H23N5O4S2/c1-4-25(5-2)31(28,29)17-8-6-7-15(13-17)18-21-22-20(24(18)3)30-16-11-9-14(10-12-16)19(26)23-27/h6-13,27H,4-5H2,1-3H3,(H,23,26) |
| InChIKey | HTWSGOAKJGRUTD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|