C31H27N3 — CID 135358069
3,5-bis[(2S)-2-phenyl-2-pyridin-2-ylethyl]pyridine (PubChem CID 135358069) has the molecular formula C31H27N3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3,5-bis[(2S)-2-phenyl-2-pyridin-2-ylethyl]pyridine.
| Compound Name | 3,5-bis[(2S)-2-phenyl-2-pyridin-2-ylethyl]pyridine |
|---|---|
| PubChem CID | 135358069 |
| Molecular Formula | C31H27N3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3,5-bis[(2S)-2-phenyl-2-pyridin-2-ylethyl]pyridine |
| SMILES | c1ccc([C@H](Cc2cncc(C[C@@H](c3ccccc3)c3ccccn3)c2)c2ccccn2)cc1 |
| InChI | InChI=1S/C31H27N3/c1-3-11-26(12-4-1)28(30-15-7-9-17-33-30)20-24-19-25(23-32-22-24)21-29(27-13-5-2-6-14-27)31-16-8-10-18-34-31/h1-19,22-23,28-29H,20-21H2/t28-,29-/m0/s1 |
| InChIKey | NTXLXBJUHGSQCS-VMPREFPWSA-N |
| XLogP | 6.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |