C15H12Cl2N2O2 — CID 135358756
[6-chloro-5-[(4-chlorophenyl)methoxy]-1H-benzimidazol-2-yl]methanol (PubChem CID 135358756) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is [6-chloro-5-[(4-chlorophenyl)methoxy]-1H-benzimidazol-2-yl]methanol.
| Compound Name | [6-chloro-5-[(4-chlorophenyl)methoxy]-1H-benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 135358756 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | [6-chloro-5-[(4-chlorophenyl)methoxy]-1H-benzimidazol-2-yl]methanol |
| SMILES | OCc1nc2cc(OCc3ccc(Cl)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-10-3-1-9(2-4-10)8-21-14-6-13-12(5-11(14)17)18-15(7-20)19-13/h1-6,20H,7-8H2,(H,18,19) |
| InChIKey | PRYNCVRHKHHFMJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |