C18H16Cl2N2O2 — CID 50754078
5,6-dichloro-2-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1H-benzimidazole (PubChem CID 50754078) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 5,6-dichloro-2-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1H-benzimidazole.
| Compound Name | 5,6-dichloro-2-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 50754078 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 5,6-dichloro-2-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1H-benzimidazole |
| SMILES | C=CCc1ccc(OCc2nc3cc(Cl)c(Cl)cc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-3-4-11-5-6-16(17(7-11)23-2)24-10-18-21-14-8-12(19)13(20)9-15(14)22-18/h3,5-9H,1,4,10H2,2H3,(H,21,22) |
| InChIKey | MDXNYTCPWWRKAI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|