C15H14ClFN2O3 — CID 135358852
N-[2-amino-4-chloro-5-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxyacetamide (PubChem CID 135358852) has the molecular formula C15H14ClFN2O3 and a molecular weight of 324.74 g/mol. Its IUPAC name is N-[2-amino-4-chloro-5-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxyacetamide.
| Compound Name | N-[2-amino-4-chloro-5-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 135358852 |
| Molecular Formula | C15H14ClFN2O3 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[2-amino-4-chloro-5-[(3-fluorophenyl)methoxy]phenyl]-2-hydroxyacetamide |
| SMILES | Nc1cc(Cl)c(OCc2cccc(F)c2)cc1NC(=O)CO |
| InChI | InChI=1S/C15H14ClFN2O3/c16-11-5-12(18)13(19-15(21)7-20)6-14(11)22-8-9-2-1-3-10(17)4-9/h1-6,20H,7-8,18H2,(H,19,21) |
| InChIKey | XRNQNRCAYYHOQO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|