C24H21ClN4O2 — CID 135361130
5-[2-chloro-4-[(3S)-3-phenylmorpholin-4-yl]quinazolin-6-yl]-1-methylpyridin-2-one (PubChem CID 135361130) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 5-[2-chloro-4-[(3S)-3-phenylmorpholin-4-yl]quinazolin-6-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[2-chloro-4-[(3S)-3-phenylmorpholin-4-yl]quinazolin-6-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 135361130 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-[2-chloro-4-[(3S)-3-phenylmorpholin-4-yl]quinazolin-6-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(-c2ccc3nc(Cl)nc(N4CCOC[C@@H]4c4ccccc4)c3c2)ccc1=O |
| InChI | InChI=1S/C24H21ClN4O2/c1-28-14-18(8-10-22(28)30)17-7-9-20-19(13-17)23(27-24(25)26-20)29-11-12-31-15-21(29)16-5-3-2-4-6-16/h2-10,13-14,21H,11-12,15H2,1H3/t21-/m1/s1 |
| InChIKey | VBBALTMISDJCNW-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |