C26H26N6O3S — CID 175355937
6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(3-phenylmorpholin-4-yl)-N-(thiazetidin-3-yl)quinazoline-2-carboxamide (PubChem CID 175355937) has the molecular formula C26H26N6O3S and a molecular weight of 502.60 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(3-phenylmorpholin-4-yl)-N-(thiazetidin-3-yl)quinazoline-2-carboxamide.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(3-phenylmorpholin-4-yl)-N-(thiazetidin-3-yl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 175355937 |
| Molecular Formula | C26H26N6O3S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(3-phenylmorpholin-4-yl)-N-(thiazetidin-3-yl)quinazoline-2-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2nc(C(=O)NC3CSN3)nc(N3CCOCC3c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H26N6O3S/c1-15-23(16(2)35-30-15)18-8-9-20-19(12-18)25(29-24(27-20)26(33)28-22-14-36-31-22)32-10-11-34-13-21(32)17-6-4-3-5-7-17/h3-9,12,21-22,31H,10-11,13-14H2,1-2H3,(H,28,33) |
| InChIKey | FEEDEKJVQGLOLE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|