C18H15F5N2O3S — CID 135363016
N-(2-methylphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide (PubChem CID 135363016) has the molecular formula C18H15F5N2O3S and a molecular weight of 434.39 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide.
| Compound Name | N-(2-methylphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide |
|---|---|
| PubChem CID | 135363016 |
| Molecular Formula | C18H15F5N2O3S |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-(2-methylphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1c(NC(=O)C(F)(F)C(F)(F)F)sc2c1CCOC2 |
| InChI | InChI=1S/C18H15F5N2O3S/c1-9-4-2-3-5-11(9)24-14(26)13-10-6-7-28-8-12(10)29-15(13)25-16(27)17(19,20)18(21,22)23/h2-5H,6-8H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | XFFOELBIIQXPCJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|