C13H11F2NO2S — CID 135366898
(3S)-3-amino-3-[5-(2,4-difluorophenyl)thiophen-2-yl]propanoic acid (PubChem CID 135366898) has the molecular formula C13H11F2NO2S and a molecular weight of 283.30 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-(2,4-difluorophenyl)thiophen-2-yl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[5-(2,4-difluorophenyl)thiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 135366898 |
| Molecular Formula | C13H11F2NO2S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (3S)-3-amino-3-[5-(2,4-difluorophenyl)thiophen-2-yl]propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1ccc(-c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C13H11F2NO2S/c14-7-1-2-8(9(15)5-7)11-3-4-12(19-11)10(16)6-13(17)18/h1-5,10H,6,16H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | VMUPJMHQKBJIPG-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |