C15H13F2NO2S — CID 15485242
(E)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoic acid (PubChem CID 15485242) has the molecular formula C15H13F2NO2S and a molecular weight of 309.34 g/mol. Its IUPAC name is (E)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoic acid.
| Compound Name | (E)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 15485242 |
| Molecular Formula | C15H13F2NO2S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (E)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoic acid |
| SMILES | NC(C/C=C(/c1ccsc1)c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C15H13F2NO2S/c16-10-1-2-12(13(17)7-10)11(9-5-6-21-8-9)3-4-14(18)15(19)20/h1-3,5-8,14H,4,18H2,(H,19,20)/b11-3- |
| InChIKey | HZJDVLYSPPQMTL-JYOAFUTRSA-N |
| XLogP | 3.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |