C15H12F2NNaO2S — CID 23710771
sodium (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate (PubChem CID 23710771) has the molecular formula C15H12F2NNaO2S and a molecular weight of 331.32 g/mol. Its IUPAC name is sodium (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate.
| Compound Name | sodium (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate |
|---|---|
| PubChem CID | 23710771 |
| Molecular Formula | C15H12F2NNaO2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | sodium (Z)-2-amino-5-(2,4-difluorophenyl)-5-thiophen-3-ylpent-4-enoate |
| SMILES | NC(C/C=C(\c1ccsc1)c1ccc(F)cc1F)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H13F2NO2S.Na/c16-10-1-2-12(13(17)7-10)11(9-5-6-21-8-9)3-4-14(18)15(19)20;/h1-3,5-8,14H,4,18H2,(H,19,20);/q;+1/p-1/b11-3+; |
| InChIKey | WEPXGJOEDSBVKK-KODGKZAJSA-M |
| XLogP | -1.07 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |