C24H23FN6O2 — CID 135369116
N-[2-(dimethylamino)-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 135369116) has the molecular formula C24H23FN6O2 and a molecular weight of 446.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-(dimethylamino)-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135369116 |
| Molecular Formula | C24H23FN6O2 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[2-(dimethylamino)-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3ccc4cc(F)ccc43)n2)c(OC)cc1N(C)C |
| InChI | InChI=1S/C24H23FN6O2/c1-5-23(32)27-17-13-18(21(33-4)14-20(17)30(2)3)28-24-26-10-8-22(29-24)31-11-9-15-12-16(25)6-7-19(15)31/h5-14H,1H2,2-4H3,(H,27,32)(H,26,28,29) |
| InChIKey | JZJYMMNOJIQOPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|