C29H32FN7O2 — CID 137421767
N-[2-[4-(dimethylamino)piperidin-1-yl]-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 137421767) has the molecular formula C29H32FN7O2 and a molecular weight of 529.62 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)piperidin-1-yl]-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[4-(dimethylamino)piperidin-1-yl]-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 137421767 |
| Molecular Formula | C29H32FN7O2 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | N-[2-[4-(dimethylamino)piperidin-1-yl]-5-[[4-(5-fluoroindol-1-yl)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-n3ccc4cc(F)ccc43)n2)c(OC)cc1N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C29H32FN7O2/c1-5-28(38)32-22-17-23(26(39-4)18-25(22)36-13-10-21(11-14-36)35(2)3)33-29-31-12-8-27(34-29)37-15-9-19-16-20(30)6-7-24(19)37/h5-9,12,15-18,21H,1,10-11,13-14H2,2-4H3,(H,32,38)(H,31,33,34) |
| InChIKey | BNFDNJLWIHXHPQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|