C28H31N7O2 — CID 141461609
N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-3-[(4-indol-1-ylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 141461609) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-3-[(4-indol-1-ylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-3-[(4-indol-1-ylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 141461609 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-3-[(4-indol-1-ylpyrimidin-2-yl)amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2nccc(-n3ccc4ccccc43)n2)c1N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C28H31N7O2/c1-5-25(36)30-21-10-11-23(37-4)26(27(21)34-16-14-20(18-34)33(2)3)32-28-29-15-12-24(31-28)35-17-13-19-8-6-7-9-22(19)35/h5-13,15,17,20H,1,14,16,18H2,2-4H3,(H,30,36)(H,29,31,32) |
| InChIKey | OXROPNFIAUVBGR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|