C28H44INO6 — CID 135373232
[2-[(4-hydroxy-2-iodo-5-methoxyphenyl)methylamino]-2-oxoethyl] (Z)-12-hydroxyoctadec-9-enoate (PubChem CID 135373232) has the molecular formula C28H44INO6 and a molecular weight of 617.57 g/mol. Its IUPAC name is [2-[(4-hydroxy-2-iodo-5-methoxyphenyl)methylamino]-2-oxoethyl] (Z)-12-hydroxyoctadec-9-enoate.
| Compound Name | [2-[(4-hydroxy-2-iodo-5-methoxyphenyl)methylamino]-2-oxoethyl] (Z)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 135373232 |
| Molecular Formula | C28H44INO6 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | [2-[(4-hydroxy-2-iodo-5-methoxyphenyl)methylamino]-2-oxoethyl] (Z)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCCC(=O)OCC(=O)NCc1cc(OC)c(O)cc1I |
| InChI | InChI=1S/C28H44INO6/c1-3-4-5-12-15-23(31)16-13-10-8-6-7-9-11-14-17-28(34)36-21-27(33)30-20-22-18-26(35-2)25(32)19-24(22)29/h10,13,18-19,23,31-32H,3-9,11-12,14-17,20-21H2,1-2H3,(H,30,33)/b13-10- |
| InChIKey | LMFLLKWLKREOHE-RAXLEYEMSA-N |
| XLogP | 6.17 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|