C22H28N2O4 — CID 135375272
(3aS)-2-[2-hydroxy-2-(5-hydroxy-2-pyridinyl)ethyl]-5-[(3-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 135375272) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3aS)-2-[2-hydroxy-2-(5-hydroxy-2-pyridinyl)ethyl]-5-[(3-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aS)-2-[2-hydroxy-2-(5-hydroxy-2-pyridinyl)ethyl]-5-[(3-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 135375272 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (3aS)-2-[2-hydroxy-2-(5-hydroxy-2-pyridinyl)ethyl]-5-[(3-methoxyphenyl)methyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | COc1cccc(CC2(O)CC3CN(CC(O)c4ccc(O)cn4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-28-19-4-2-3-15(7-19)8-22(27)9-16-12-24(13-17(16)10-22)14-21(26)20-6-5-18(25)11-23-20/h2-7,11,16-17,21,25-27H,8-10,12-14H2,1H3/t16-,17?,21?,22?/m1/s1 |
| InChIKey | BGUAZLFACUDSKG-WGQVSMNOSA-N |
| XLogP | 2.14 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |