C11H20N2O3 — CID 135375416
2-tert-butyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylic acid (PubChem CID 135375416) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-tert-butyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylic acid.
| Compound Name | 2-tert-butyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylic acid |
|---|---|
| PubChem CID | 135375416 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-tert-butyl-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)C2CNCC2O1 |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)9-6-13(10(14)15)7-4-12-5-8(7)16-9/h7-9,12H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | YBMBSWSVOHOERJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |