About (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid
(1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid (PubChem CID 68697896) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid |
| PubChem CID | 68697896 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid |
| SMILES | O=C(O)N1C[C@@H]2CCNC[C@@H]21 |
| InChI | InChI=1S/C7H12N2O2/c10-7(11)9-4-5-1-2-8-3-6(5)9/h5-6,8H,1-4H2,(H,10,11)/t5-,6-/m0/s1 |
| InChIKey | DDLFHTXPHNHBIE-WDSKDSINSA-N |
| XLogP | -0.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid?
The IUPAC name of (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid (CID 68697896) is (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid.
What is the SMILES notation for (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid?
The canonical SMILES for (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid is O=C(O)N1C[C@@H]2CCNC[C@@H]21.
What is the InChIKey of (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid?
The InChIKey is DDLFHTXPHNHBIE-WDSKDSINSA-N. The full InChI is InChI=1S/C7H12N2O2/c10-7(11)9-4-5-1-2-8-3-6(5)9/h5-6,8H,1-4H2,(H,10,11)/t5-,6-/m0/s1.
What are the key properties of (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid?
(1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid has a molecular weight of 156.18 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylic acid is sourced from PubChem (CID 68697896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).