C12H15F2NO3 — CID 135376917
2,2-difluoro-2-[2-[1-(methoxymethoxy)ethyl]phenyl]acetamide (PubChem CID 135376917) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 2,2-difluoro-2-[2-[1-(methoxymethoxy)ethyl]phenyl]acetamide.
| Compound Name | 2,2-difluoro-2-[2-[1-(methoxymethoxy)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135376917 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,2-difluoro-2-[2-[1-(methoxymethoxy)ethyl]phenyl]acetamide |
| SMILES | COCOC(C)c1ccccc1C(F)(F)C(N)=O |
| InChI | InChI=1S/C12H15F2NO3/c1-8(18-7-17-2)9-5-3-4-6-10(9)12(13,14)11(15)16/h3-6,8H,7H2,1-2H3,(H2,15,16) |
| InChIKey | POVZOXXBXZEFDE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|