C15H18BrF3O3 — CID 123421549
methyl 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 123421549) has the molecular formula C15H18BrF3O3 and a molecular weight of 383.20 g/mol. Its IUPAC name is methyl 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 123421549 |
| Molecular Formula | C15H18BrF3O3 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | methyl 2-[2-bromo-3-(trifluoromethyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)C(COC(C)(C)C)c1cccc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C15H18BrF3O3/c1-14(2,3)22-8-10(13(20)21-4)9-6-5-7-11(12(9)16)15(17,18)19/h5-7,10H,8H2,1-4H3 |
| InChIKey | AEPUCTOWBJTKFP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |