C15H9BrN2 — CID 135379645
9-bromo-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene (PubChem CID 135379645) has the molecular formula C15H9BrN2 and a molecular weight of 297.16 g/mol. Its IUPAC name is 9-bromo-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene.
| Compound Name | 9-bromo-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 135379645 |
| Molecular Formula | C15H9BrN2 |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 9-bromo-2,8-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7(12),8,10,13,15-octaene |
| SMILES | Brc1ccc2c3ccccc3n3cccc3c2n1 |
| InChI | InChI=1S/C15H9BrN2/c16-14-8-7-11-10-4-1-2-5-12(10)18-9-3-6-13(18)15(11)17-14/h1-9H |
| InChIKey | CKXKCIBRZFLOPD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|