C12H10N2 — CID 96627935
pyrido[1,2-a]indol-10-amine (PubChem CID 96627935) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is pyrido[1,2-a]indol-10-amine.
| Compound Name | pyrido[1,2-a]indol-10-amine |
|---|---|
| PubChem CID | 96627935 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | pyrido[1,2-a]indol-10-amine |
| SMILES | Nc1c2ccccc2n2ccccc12 |
| InChI | InChI=1S/C12H10N2/c13-12-9-5-1-2-6-10(9)14-8-4-3-7-11(12)14/h1-8H,13H2 |
| InChIKey | NVGBAKBNBNUKCY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |