About 1-aminoquinolizin-4-one;dihydrobromide
1-aminoquinolizin-4-one;dihydrobromide (PubChem CID 131863713) has the molecular formula C9H10Br2N2O
and a molecular weight of 322.00 g/mol. Its IUPAC name is 1-aminoquinolizin-4-one;dihydrobromide.
Molecular Properties
| Compound Name | 1-aminoquinolizin-4-one;dihydrobromide |
| PubChem CID | 131863713 |
| Molecular Formula | C9H10Br2N2O |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 1-aminoquinolizin-4-one;dihydrobromide |
| SMILES | Br.Br.Nc1ccc(=O)n2ccccc12 |
| InChI | InChI=1S/C9H8N2O.2BrH/c10-7-4-5-9(12)11-6-2-1-3-8(7)11;;/h1-6H,10H2;2*1H |
| InChIKey | RNWDBWFOEQVDBT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminoquinolizin-4-one;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoquinolizin-4-one;dihydrobromide?
The IUPAC name of 1-aminoquinolizin-4-one;dihydrobromide (CID 131863713) is 1-aminoquinolizin-4-one;dihydrobromide.
What is the SMILES notation for 1-aminoquinolizin-4-one;dihydrobromide?
The canonical SMILES for 1-aminoquinolizin-4-one;dihydrobromide is Br.Br.Nc1ccc(=O)n2ccccc12.
What is the InChIKey of 1-aminoquinolizin-4-one;dihydrobromide?
The InChIKey is RNWDBWFOEQVDBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.2BrH/c10-7-4-5-9(12)11-6-2-1-3-8(7)11;;/h1-6H,10H2;2*1H.
What are the key properties of 1-aminoquinolizin-4-one;dihydrobromide?
1-aminoquinolizin-4-one;dihydrobromide has a molecular weight of 322.00 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoquinolizin-4-one;dihydrobromide is sourced from PubChem (CID 131863713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).