C14H11ClF5N3O — CID 135381332
6-chloro-N-[2-[2-(difluoromethoxy)-3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 135381332) has the molecular formula C14H11ClF5N3O and a molecular weight of 367.71 g/mol. Its IUPAC name is 6-chloro-N-[2-[2-(difluoromethoxy)-3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-[2-(difluoromethoxy)-3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 135381332 |
| Molecular Formula | C14H11ClF5N3O |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 6-chloro-N-[2-[2-(difluoromethoxy)-3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | FC(F)Oc1c(CCNc2cc(Cl)ncn2)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H11ClF5N3O/c15-10-6-11(23-7-22-10)21-5-4-8-2-1-3-9(14(18,19)20)12(8)24-13(16)17/h1-3,6-7,13H,4-5H2,(H,21,22,23) |
| InChIKey | IIMHIKCQRKDSSB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |