C17H13F4N3 — CID 67600804
8-fluoro-N-[2-[2-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 67600804) has the molecular formula C17H13F4N3 and a molecular weight of 335.30 g/mol. Its IUPAC name is 8-fluoro-N-[2-[2-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 8-fluoro-N-[2-[2-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67600804 |
| Molecular Formula | C17H13F4N3 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 8-fluoro-N-[2-[2-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | Fc1cccc2c(NCCc3ccccc3C(F)(F)F)ncnc12 |
| InChI | InChI=1S/C17H13F4N3/c18-14-7-3-5-12-15(14)23-10-24-16(12)22-9-8-11-4-1-2-6-13(11)17(19,20)21/h1-7,10H,8-9H2,(H,22,23,24) |
| InChIKey | JFDOISLXWAGVQS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |