C13H16F3N3O2 — CID 135382591
ethyl 4-(difluoromethyl)-1-(5-fluoropyrimidin-2-yl)piperidine-4-carboxylate (PubChem CID 135382591) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-1-(5-fluoropyrimidin-2-yl)piperidine-4-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-1-(5-fluoropyrimidin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135382591 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl 4-(difluoromethyl)-1-(5-fluoropyrimidin-2-yl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(C(F)F)CCN(c2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-2-21-11(20)13(10(15)16)3-5-19(6-4-13)12-17-7-9(14)8-18-12/h7-8,10H,2-6H2,1H3 |
| InChIKey | HKGICEMFXAJUDS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |