About dichlorozinc;methanidylbenzene;hydrochloride
dichlorozinc;methanidylbenzene;hydrochloride (PubChem CID 135382974) has the molecular formula C7H8Cl3Zn-
and a molecular weight of 263.89 g/mol. Its IUPAC name is dichlorozinc;methanidylbenzene;hydrochloride.
Molecular Properties
| Compound Name | dichlorozinc;methanidylbenzene;hydrochloride |
| PubChem CID | 135382974 |
| Molecular Formula | C7H8Cl3Zn- |
| Molecular Weight | 263.89 g/mol |
| Exact Mass | 260.90 |
| IUPAC Name | dichlorozinc;methanidylbenzene;hydrochloride |
| SMILES | Cl.Cl[Zn]Cl.[CH2-]c1ccccc1 |
| InChI | InChI=1S/C7H7.3ClH.Zn/c1-7-5-3-2-4-6-7;;;;/h2-6H,1H2;3*1H;/q-1;;;;+2/p-2 |
| InChIKey | QAUKOGKSRFDDDY-UHFFFAOYSA-L |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;methanidylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;methanidylbenzene;hydrochloride?
The IUPAC name of dichlorozinc;methanidylbenzene;hydrochloride (CID 135382974) is dichlorozinc;methanidylbenzene;hydrochloride.
What is the SMILES notation for dichlorozinc;methanidylbenzene;hydrochloride?
The canonical SMILES for dichlorozinc;methanidylbenzene;hydrochloride is Cl.Cl[Zn]Cl.[CH2-]c1ccccc1.
What is the InChIKey of dichlorozinc;methanidylbenzene;hydrochloride?
The InChIKey is QAUKOGKSRFDDDY-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H7.3ClH.Zn/c1-7-5-3-2-4-6-7;;;;/h2-6H,1H2;3*1H;/q-1;;;;+2/p-2.
What are the key properties of dichlorozinc;methanidylbenzene;hydrochloride?
dichlorozinc;methanidylbenzene;hydrochloride has a molecular weight of 263.89 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;methanidylbenzene;hydrochloride is sourced from PubChem (CID 135382974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).