C28H30F3N5O3 — CID 135385325
4-methyl-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-9-yloxy)benzamide (PubChem CID 135385325) has the molecular formula C28H30F3N5O3 and a molecular weight of 541.57 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-9-yloxy)benzamide.
| Compound Name | 4-methyl-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-9-yloxy)benzamide |
|---|---|
| PubChem CID | 135385325 |
| Molecular Formula | C28H30F3N5O3 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-methyl-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-9-yloxy)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(N3CCN(C)CC3)cc(C(F)(F)F)c2)cc1Oc1ccnc2c1OCCCN2 |
| InChI | InChI=1S/C28H30F3N5O3/c1-18-4-5-19(14-24(18)39-23-6-8-33-26-25(23)38-13-3-7-32-26)27(37)34-21-15-20(28(29,30)31)16-22(17-21)36-11-9-35(2)10-12-36/h4-6,8,14-17H,3,7,9-13H2,1-2H3,(H,32,33)(H,34,37) |
| InChIKey | XBPZYCCPDRDFSB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |