C26H25ClF3N5O4 — CID 135385705
4-chloro-3-(7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazin-4-yloxy)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 135385705) has the molecular formula C26H25ClF3N5O4 and a molecular weight of 563.96 g/mol. Its IUPAC name is 4-chloro-3-(7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazin-4-yloxy)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-(7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazin-4-yloxy)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 135385705 |
| Molecular Formula | C26H25ClF3N5O4 |
| Molecular Weight | 563.96 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 4-chloro-3-(7,8-dihydro-6H-pyrimido[5,4-b][1,4]oxazin-4-yloxy)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | C[C@@H]1CN(c2cc(NC(=O)c3ccc(Cl)c(Oc4ncnc5c4OCCN5)c3)cc(C(F)(F)F)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C26H25ClF3N5O4/c1-14-11-35(12-15(2)38-14)19-9-17(26(28,29)30)8-18(10-19)34-24(36)16-3-4-20(27)21(7-16)39-25-22-23(32-13-33-25)31-5-6-37-22/h3-4,7-10,13-15H,5-6,11-12H2,1-2H3,(H,34,36)(H,31,32,33)/t14-,15+ |
| InChIKey | UKBAWGLUJZLBBF-GASCZTMLSA-N |
| XLogP | 5.61 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |