C20H19ClN6O2 — CID 135386797
2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-methylpropanamide (PubChem CID 135386797) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-methylpropanamide.
| Compound Name | 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 135386797 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12 |
| InChI | InChI=1S/C20H19ClN6O2/c1-11(20(29)23-2)25-16-9-18(28)27(3)17-5-4-12(8-13(16)17)26-15-6-7-24-19(21)14(15)10-22/h4-9,11,25H,1-3H3,(H,23,29)(H,24,26) |
| InChIKey | FADZTVPDTJJNJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|