C21H17ClN6O2 — CID 135387020
2-chloro-4-[[1-methyl-4-[1-(1,3-oxazol-2-yl)ethylamino]-2-oxoquinolin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 135387020) has the molecular formula C21H17ClN6O2 and a molecular weight of 420.86 g/mol. Its IUPAC name is 2-chloro-4-[[1-methyl-4-[1-(1,3-oxazol-2-yl)ethylamino]-2-oxoquinolin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[1-methyl-4-[1-(1,3-oxazol-2-yl)ethylamino]-2-oxoquinolin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135387020 |
| Molecular Formula | C21H17ClN6O2 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-chloro-4-[[1-methyl-4-[1-(1,3-oxazol-2-yl)ethylamino]-2-oxoquinolin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CC(Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12)c1ncco1 |
| InChI | InChI=1S/C21H17ClN6O2/c1-12(21-25-7-8-30-21)26-17-10-19(29)28(2)18-4-3-13(9-14(17)18)27-16-5-6-24-20(22)15(16)11-23/h3-10,12,26H,1-2H3,(H,24,27) |
| InChIKey | KHUZWZBJQFESGS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|