C24H25ClN6O2 — CID 135386564
(2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-cyclopentylpropanamide (PubChem CID 135386564) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-cyclopentylpropanamide.
| Compound Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 135386564 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-cyclopentylpropanamide |
| SMILES | C[C@@H](Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H25ClN6O2/c1-14(24(33)30-15-5-3-4-6-15)28-20-12-22(32)31(2)21-8-7-16(11-17(20)21)29-19-9-10-27-23(25)18(19)13-26/h7-12,14-15,28H,3-6H2,1-2H3,(H,27,29)(H,30,33)/t14-/m1/s1 |
| InChIKey | HFXLBWNSMJYTRE-CQSZACIVSA-N |
| XLogP | 4.06 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|