C20H18ClN5O2 — CID 135385568
2-chloro-4-[[1-methyl-2-oxo-4-[[(3S)-oxolan-3-yl]amino]quinolin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 135385568) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-chloro-4-[[1-methyl-2-oxo-4-[[(3S)-oxolan-3-yl]amino]quinolin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[1-methyl-2-oxo-4-[[(3S)-oxolan-3-yl]amino]quinolin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135385568 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-chloro-4-[[1-methyl-2-oxo-4-[[(3S)-oxolan-3-yl]amino]quinolin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | Cn1c(=O)cc(N[C@H]2CCOC2)c2cc(Nc3ccnc(Cl)c3C#N)ccc21 |
| InChI | InChI=1S/C20H18ClN5O2/c1-26-18-3-2-12(24-16-4-6-23-20(21)15(16)10-22)8-14(18)17(9-19(26)27)25-13-5-7-28-11-13/h2-4,6,8-9,13,25H,5,7,11H2,1H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | VKAXDUQPBDPGOC-ZDUSSCGKSA-N |
| XLogP | 3.40 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|