C21H21ClN6O3 — CID 135386735
(2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-hydroxyethyl)propanamide (PubChem CID 135386735) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-hydroxyethyl)propanamide.
| Compound Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 135386735 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-hydroxyethyl)propanamide |
| SMILES | C[C@@H](Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12)C(=O)NCCO |
| InChI | InChI=1S/C21H21ClN6O3/c1-12(21(31)25-7-8-29)26-17-10-19(30)28(2)18-4-3-13(9-14(17)18)27-16-5-6-24-20(22)15(16)11-23/h3-6,9-10,12,26,29H,7-8H2,1-2H3,(H,24,27)(H,25,31)/t12-/m1/s1 |
| InChIKey | GOZYWZBQJIJLQF-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|