C21H21ClN6O2 — CID 142478379
2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-ethylpropanamide (PubChem CID 142478379) has the molecular formula C21H21ClN6O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-ethylpropanamide.
| Compound Name | 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 142478379 |
| Molecular Formula | C21H21ClN6O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12 |
| InChI | InChI=1S/C21H21ClN6O2/c1-4-24-21(30)12(2)26-17-10-19(29)28(3)18-6-5-13(9-14(17)18)27-16-7-8-25-20(22)15(16)11-23/h5-10,12,26H,4H2,1-3H3,(H,24,30)(H,25,27) |
| InChIKey | SMPBOKOUEFIMJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|