C22H23ClN6O3 — CID 135385600
(2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 135385600) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 135385600 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (2R)-2-[[6-[(2-chloro-3-cyano-4-pyridinyl)amino]-1-methyl-2-oxoquinolin-4-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12 |
| InChI | InChI=1S/C22H23ClN6O3/c1-13(22(31)26-8-9-32-3)27-18-11-20(30)29(2)19-5-4-14(10-15(18)19)28-17-6-7-25-21(23)16(17)12-24/h4-7,10-11,13,27H,8-9H2,1-3H3,(H,25,28)(H,26,31)/t13-/m1/s1 |
| InChIKey | HOIRYVQAFGTJBV-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|