2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid

C12H13N3O2S — CID 135386900

IUPAC2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid
SMILESO=C(O)c1cc2sc(N3CCCCC3)nc2cn1
InChIInChI=1S/C12H13N3O2S/c16-11(17)8-6-10-9(7-13-8)14-12(18-10)15-4-2-1-3-5-15/h6-7H,1-5H2,(H,16,17)
InChIKeyKLDXQCNTTSCUBK-UHFFFAOYSA-N
MW263.32 g/mol
LogP2.38
Rot. Bonds2

About 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid

2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 135386900) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid
PubChem CID135386900
Molecular FormulaC12H13N3O2S
Molecular Weight263.32 g/mol
Exact Mass263.07
IUPAC Name2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid
SMILESO=C(O)c1cc2sc(N3CCCCC3)nc2cn1
InChIInChI=1S/C12H13N3O2S/c16-11(17)8-6-10-9(7-13-8)14-12(18-10)15-4-2-1-3-5-15/h6-7H,1-5H2,(H,16,17)
InChIKeyKLDXQCNTTSCUBK-UHFFFAOYSA-N
XLogP2.38
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid?
The IUPAC name of 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid (CID 135386900) is 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid.
What is the SMILES notation for 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid?
The canonical SMILES for 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid is O=C(O)c1cc2sc(N3CCCCC3)nc2cn1.
What is the InChIKey of 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid?
The InChIKey is KLDXQCNTTSCUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2S/c16-11(17)8-6-10-9(7-13-8)14-12(18-10)15-4-2-1-3-5-15/h6-7H,1-5H2,(H,16,17).
What are the key properties of 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid?
2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid has a molecular weight of 263.32 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-[1,3]thiazolo[4,5-c]pyridine-6-carboxylic acid is sourced from PubChem (CID 135386900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).