2-(3,3,4,4-tetramethylcyclopentyl)acetic acid

C11H20O2 — CID 135389559

IUPAC2-(3,3,4,4-tetramethylcyclopentyl)acetic acid
SMILESCC1(C)CC(CC(=O)O)CC1(C)C
InChIInChI=1S/C11H20O2/c1-10(2)6-8(5-9(12)13)7-11(10,3)4/h8H,5-7H2,1-4H3,(H,12,13)
InChIKeyWFKSMBDZRPZNMF-UHFFFAOYSA-N
MW184.28 g/mol
LogP2.92
Rot. Bonds2

About 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid

2-(3,3,4,4-tetramethylcyclopentyl)acetic acid (PubChem CID 135389559) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid.

Molecular Properties

Compound Name2-(3,3,4,4-tetramethylcyclopentyl)acetic acid
PubChem CID135389559
Molecular FormulaC11H20O2
Molecular Weight184.28 g/mol
Exact Mass184.15
IUPAC Name2-(3,3,4,4-tetramethylcyclopentyl)acetic acid
SMILESCC1(C)CC(CC(=O)O)CC1(C)C
InChIInChI=1S/C11H20O2/c1-10(2)6-8(5-9(12)13)7-11(10,3)4/h8H,5-7H2,1-4H3,(H,12,13)
InChIKeyWFKSMBDZRPZNMF-UHFFFAOYSA-N
XLogP2.92
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.28
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid?
The IUPAC name of 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid (CID 135389559) is 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid.
What is the SMILES notation for 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid?
The canonical SMILES for 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid is CC1(C)CC(CC(=O)O)CC1(C)C.
What is the InChIKey of 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid?
The InChIKey is WFKSMBDZRPZNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-10(2)6-8(5-9(12)13)7-11(10,3)4/h8H,5-7H2,1-4H3,(H,12,13).
What are the key properties of 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid?
2-(3,3,4,4-tetramethylcyclopentyl)acetic acid has a molecular weight of 184.28 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,4,4-tetramethylcyclopentyl)acetic acid is sourced from PubChem (CID 135389559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).