C12H22O2 — CID 123185635
2-(4,4-diethylcyclohexyl)acetic acid (PubChem CID 123185635) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(4,4-diethylcyclohexyl)acetic acid.
| Compound Name | 2-(4,4-diethylcyclohexyl)acetic acid |
|---|---|
| PubChem CID | 123185635 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-(4,4-diethylcyclohexyl)acetic acid |
| SMILES | CCC1(CC)CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22O2/c1-3-12(4-2)7-5-10(6-8-12)9-11(13)14/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | UGNGXCRLRVBTGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |